CAS 1241914-87-3 is the registry number for AC-430. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-fluorophenyl)-[4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]methanol (CAS 1241914-87-3) is a chemical compound with the molecular formula C19H16FN5O and a molecular weight of 349.4 g/mol. IUPAC name: (4-fluorophenyl)-[4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]methanol. InChIKey: DCRWIATZWHLIPN-UHFFFAOYSA-N.
| Molecular formula | C19H16FN5O |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | (4-fluorophenyl)-[4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]methanol |
| InChIKey | DCRWIATZWHLIPN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC3=CC=CC=C32)C(C4=CC=C(C=C4)F)O |
Computed by PubChem (NCBI)