CAS 1241948-58-2 appears in our catalog under these names: 5-Bromo-2,3-difluoro-4-(trimethylsilyl)benzoic acid, 95%, 5-Bromo-2,3-difluoro-4-(trimethylsilyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-bromo-2,3-difluoro-4-trimethylsilylbenzoic acid (CAS 1241948-58-2) is a chemical compound with the molecular formula C10H11BrF2O2Si and a molecular weight of 309.18 g/mol. IUPAC name: 5-bromo-2,3-difluoro-4-trimethylsilylbenzoic acid. InChIKey: VYWXKBGZPJDKCK-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF2O2Si |
|---|---|
| Molecular weight | 309.18 g/mol |
| IUPAC name | 5-bromo-2,3-difluoro-4-trimethylsilylbenzoic acid |
| InChIKey | VYWXKBGZPJDKCK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=C(C(=C1F)F)C(=O)O)Br |
Computed by PubChem (NCBI)