CAS 1241950-75-3 is the registry number for 2-Chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1241950-75-3) is a chemical compound with the molecular formula C11H14BClINO2 and a molecular weight of 365.40 g/mol. IUPAC name: 2-chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YREHTQZLXDCHCP-UHFFFAOYSA-N.
| Molecular formula | C11H14BClINO2 |
|---|---|
| Molecular weight | 365.40 g/mol |
| IUPAC name | 2-chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YREHTQZLXDCHCP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2Cl)I |
Computed by PubChem (NCBI)