CAS 1242013-52-0 is the registry number for D-a-Aspartyl-D-Aspartic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[[(2R)-2-amino-3-carboxypropanoyl]amino]butanedioic acid (CAS 1242013-52-0) is a chemical compound with the molecular formula C8H12N2O7 and a molecular weight of 248.19 g/mol. IUPAC name: (2R)-2-[[(2R)-2-amino-3-carboxypropanoyl]amino]butanedioic acid. InChIKey: FRYULLIZUDQONW-QWWZWVQMSA-N.
| Molecular formula | C8H12N2O7 |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-amino-3-carboxypropanoyl]amino]butanedioic acid |
| InChIKey | FRYULLIZUDQONW-QWWZWVQMSA-N |
| SMILES | C([C@H](C(=O)N[C@H](CC(=O)O)C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)