Products 1242014-94-3
CAS 1242014-94-3 appears in our catalog under these names: 6-Fluoro-2,2-dimethyl-2H-benzo(b)(1,4)oxazin-3(4H)-one, 6-fluoro-2,2-dimethyl-3,4-dihydro-2H-1,4-benzoxazin-3-one, ≥95%, ≥95%. Offered by: Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
6-fluoro-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CAS 1242014-94-3) is a chemical compound with the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. IUPAC name: 6-fluoro-2,2-dimethyl-4H-1,4-benzoxazin-3-one. InChIKey: PEDNOLUGVPAYMZ-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO2 |
|---|---|
| Molecular weight | 195.19 g/mol |
| IUPAC name | 6-fluoro-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| InChIKey | PEDNOLUGVPAYMZ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=CC(=C2)F)C |
Computed by PubChem (NCBI)