Products 1242095-23-3
CAS 1242095-23-3 is the registry number for ((4–Chloro–3–(trifluoromethyl)phenyl)sulfonyl)valine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbutanoic acid (CAS 1242095-23-3) is a chemical compound with the molecular formula C12H13ClF3NO4S and a molecular weight of 359.75 g/mol. IUPAC name: 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbutanoic acid. InChIKey: IGSDVRVGWMUAPT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3NO4S |
|---|---|
| Molecular weight | 359.75 g/mol |
| IUPAC name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
| InChIKey | IGSDVRVGWMUAPT-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NS(=O)(=O)C1=CC(=C(C=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)