CAS 1242099-15-5 is the registry number for ((2,6-Difluorophenyl)sulfonyl)-L-phenylalanine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2,6-difluorophenyl)sulfonylamino]-3-phenylpropanoic acid (CAS 1242099-15-5) is a chemical compound with the molecular formula C15H13F2NO4S and a molecular weight of 341.3 g/mol. IUPAC name: 2-[(2,6-difluorophenyl)sulfonylamino]-3-phenylpropanoic acid. InChIKey: OPDWDUOCQIUQOZ-UHFFFAOYSA-N.
| Molecular formula | C15H13F2NO4S |
|---|---|
| Molecular weight | 341.3 g/mol |
| IUPAC name | 2-[(2,6-difluorophenyl)sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | OPDWDUOCQIUQOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NS(=O)(=O)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)