CAS 1242137-19-4 is the registry number for Enzalutamide Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]-2-fluorobenzoic acid (CAS 1242137-19-4) is a chemical compound with the molecular formula C20H13F4N3O4 and a molecular weight of 435.3 g/mol. IUPAC name: 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]-2-fluorobenzoic acid. InChIKey: HLAJSPJIWQUPBY-UHFFFAOYSA-N.
| Molecular formula | C20H13F4N3O4 |
|---|---|
| Molecular weight | 435.3 g/mol |
| IUPAC name | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxoimidazolidin-1-yl]-2-fluorobenzoic acid |
| InChIKey | HLAJSPJIWQUPBY-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1C2=CC(=C(C=C2)C(=O)O)F)C3=CC(=C(C=C3)C#N)C(F)(F)F)C |
Computed by PubChem (NCBI)