CAS 124215-50-5 appears in our catalog under these names: 2-(4-bromobutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(4-Bromobutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg.
2-(4-bromobutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 124215-50-5) is a chemical compound with the molecular formula C10H20BBrO2 and a molecular weight of 262.98 g/mol. IUPAC name: 2-(4-bromobutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JNOXVESQYIKGFF-UHFFFAOYSA-N.
| Molecular formula | C10H20BBrO2 |
|---|---|
| Molecular weight | 262.98 g/mol |
| IUPAC name | 2-(4-bromobutyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JNOXVESQYIKGFF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCCBr |
Computed by PubChem (NCBI)