CAS 1242241-00-4 is the registry number for 5-(3-(Methylsulfonyl)phenyl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
5-(3-methylsulfonylphenyl)thiophene-2-carboxylic acid (CAS 1242241-00-4) is a chemical compound with the molecular formula C12H10O4S2 and a molecular weight of 282.3 g/mol. IUPAC name: 5-(3-methylsulfonylphenyl)thiophene-2-carboxylic acid. InChIKey: FSCFZBIAVNWCOC-UHFFFAOYSA-N.
| Molecular formula | C12H10O4S2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 5-(3-methylsulfonylphenyl)thiophene-2-carboxylic acid |
| InChIKey | FSCFZBIAVNWCOC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)