Products 1242241-00-4

CAS 1242241-00-4 is the registry number for 5-(3-(Methylsulfonyl)phenyl)thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.

Structural formula: {0} (CAS {1})

5-(3-methylsulfonylphenyl)thiophene-2-carboxylic acid (CAS 1242241-00-4) is a chemical compound with the molecular formula C12H10O4S2 and a molecular weight of 282.3 g/mol. IUPAC name: 5-(3-methylsulfonylphenyl)thiophene-2-carboxylic acid. InChIKey: FSCFZBIAVNWCOC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O4S2
Molecular weight282.3 g/mol
IUPAC name5-(3-methylsulfonylphenyl)thiophene-2-carboxylic acid
InChIKeyFSCFZBIAVNWCOC-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC=CC(=C1)C2=CC=C(S2)C(=O)O

Computed by PubChem (NCBI)