CAS 1242267-77-1 is the registry number for Di-tert-butyl (S)-2-(cyanomethyl)piperazine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl (2S)-2-(cyanomethyl)piperazine-1,4-dicarboxylate (CAS 1242267-77-1) is a chemical compound with the molecular formula C16H27N3O4 and a molecular weight of 325.40 g/mol. IUPAC name: ditert-butyl (2S)-2-(cyanomethyl)piperazine-1,4-dicarboxylate. InChIKey: OCFZRXVLIYTIRX-LBPRGKRZSA-N.
| Molecular formula | C16H27N3O4 |
|---|---|
| Molecular weight | 325.40 g/mol |
| IUPAC name | ditert-butyl (2S)-2-(cyanomethyl)piperazine-1,4-dicarboxylate |
| InChIKey | OCFZRXVLIYTIRX-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)CC#N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)