CAS 1242336-65-7 is the registry number for 4,6-Dibromo-2,3-difluorophenol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4,6-dibromo-2,3-difluorophenol (CAS 1242336-65-7) is a chemical compound with the molecular formula C6H2Br2F2O and a molecular weight of 287.88 g/mol. IUPAC name: 4,6-dibromo-2,3-difluorophenol. InChIKey: XVJAVYGPVLJPCP-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F2O |
|---|---|
| Molecular weight | 287.88 g/mol |
| IUPAC name | 4,6-dibromo-2,3-difluorophenol |
| InChIKey | XVJAVYGPVLJPCP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)O)Br |
Computed by PubChem (NCBI)