CAS 1242338-85-7 is the registry number for 1-Ethyl-5-methyl-1h-pyrazole-3,4-diamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-ethyl-5-methylpyrazole-3,4-diamine;dihydrochloride (CAS 1242338-85-7) is a chemical compound with the molecular formula C6H14Cl2N4 and a molecular weight of 213.11 g/mol. IUPAC name: 1-ethyl-5-methylpyrazole-3,4-diamine;dihydrochloride. InChIKey: WLLUXZBUCTYOOO-UHFFFAOYSA-N.
| Molecular formula | C6H14Cl2N4 |
|---|---|
| Molecular weight | 213.11 g/mol |
| IUPAC name | 1-ethyl-5-methylpyrazole-3,4-diamine;dihydrochloride |
| InChIKey | WLLUXZBUCTYOOO-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)N)N)C.Cl.Cl |
Computed by PubChem (NCBI)