CAS 1242338-92-6 is the registry number for 5-(Chlorosulfonyl)-2,3,4-trifluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-chlorosulfonyl-2,3,4-trifluorobenzoic acid (CAS 1242338-92-6) is a chemical compound with the molecular formula C7H2ClF3O4S and a molecular weight of 274.60 g/mol. IUPAC name: 5-chlorosulfonyl-2,3,4-trifluorobenzoic acid. InChIKey: KYCIYMJZKNUQTD-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O4S |
|---|---|
| Molecular weight | 274.60 g/mol |
| IUPAC name | 5-chlorosulfonyl-2,3,4-trifluorobenzoic acid |
| InChIKey | KYCIYMJZKNUQTD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1S(=O)(=O)Cl)F)F)F)C(=O)O |
Computed by PubChem (NCBI)