Products 1242338-92-6

CAS 1242338-92-6 is the registry number for 5-(Chlorosulfonyl)-2,3,4-trifluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-chlorosulfonyl-2,3,4-trifluorobenzoic acid (CAS 1242338-92-6) is a chemical compound with the molecular formula C7H2ClF3O4S and a molecular weight of 274.60 g/mol. IUPAC name: 5-chlorosulfonyl-2,3,4-trifluorobenzoic acid. InChIKey: KYCIYMJZKNUQTD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2ClF3O4S
Molecular weight274.60 g/mol
IUPAC name5-chlorosulfonyl-2,3,4-trifluorobenzoic acid
InChIKeyKYCIYMJZKNUQTD-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1S(=O)(=O)Cl)F)F)F)C(=O)O

Computed by PubChem (NCBI)