Products 124251-83-8
CAS 124251-83-8 is the registry number for 5-Nitro BAPTA. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]-N-(carboxymethyl)-4-nitroanilino]acetic acid (CAS 124251-83-8) is a chemical compound with the molecular formula C22H23N3O12 and a molecular weight of 521.4 g/mol. IUPAC name: 2-[2-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]-N-(carboxymethyl)-4-nitroanilino]acetic acid. InChIKey: JRTCJLPFWVGNQV-UHFFFAOYSA-N.
| Molecular formula | C22H23N3O12 |
|---|---|
| Molecular weight | 521.4 g/mol |
| IUPAC name | 2-[2-[2-[2-[bis(carboxymethyl)amino]phenoxy]ethoxy]-N-(carboxymethyl)-4-nitroanilino]acetic acid |
| InChIKey | JRTCJLPFWVGNQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N(CC(=O)O)CC(=O)O)OCCOC2=C(C=CC(=C2)[N+](=O)[O-])N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Nitro BAPTA, orb2567175