CAS 1242567-11-8 appears in our catalog under these names: Balsalazide USP Impurity 1, Balsalazide Impurity 4, Balsalazide Impurity 6, 3-((1E)-2-(4-(((2-Carboxyethyl)amino)carbonyl)phenyl)diazenyl) balsalazide. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg.
3,5-bis[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid (CAS 1242567-11-8) is a chemical compound with the molecular formula C27H24N6O9 and a molecular weight of 576.5 g/mol. IUPAC name: 3,5-bis[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid. InChIKey: GTWSSNPLAKYAOG-UHFFFAOYSA-N.
| Molecular formula | C27H24N6O9 |
|---|---|
| Molecular weight | 576.5 g/mol |
| IUPAC name | 3,5-bis[[4-(2-carboxyethylcarbamoyl)phenyl]diazenyl]-2-hydroxybenzoic acid |
| InChIKey | GTWSSNPLAKYAOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCCC(=O)O)N=NC2=CC(=C(C(=C2)N=NC3=CC=C(C=C3)C(=O)NCCC(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)