Products 1242862-71-0
CAS 1242862-71-0 is the registry number for FUBP1-IN-2, 99.26%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10mM/1mL, 25 mg, 5 mg, 50 mg, 10 mg.
5-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-[(4-methoxybenzoyl)amino]benzoic acid (CAS 1242862-71-0) is a chemical compound with the molecular formula C26H26ClN3O4 and a molecular weight of 480.0 g/mol. IUPAC name: 5-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-[(4-methoxybenzoyl)amino]benzoic acid. InChIKey: QFJLWZSHKPVZGX-UHFFFAOYSA-N.
| Molecular formula | C26H26ClN3O4 |
|---|---|
| Molecular weight | 480.0 g/mol |
| IUPAC name | 5-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-[(4-methoxybenzoyl)amino]benzoic acid |
| InChIKey | QFJLWZSHKPVZGX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)C3=CC(=C(C=C3)NC(=O)C4=CC=C(C=C4)OC)C(=O)O |
Computed by PubChem (NCBI)