CAS 1243143-46-5 is the registry number for 2-(4-Ethoxy-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[4-ethoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1243143-46-5) is a chemical compound with the molecular formula C15H20BF3O3 and a molecular weight of 316.13 g/mol. IUPAC name: 2-[4-ethoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LFSGJKSMSGVUON-UHFFFAOYSA-N.
| Molecular formula | C15H20BF3O3 |
|---|---|
| Molecular weight | 316.13 g/mol |
| IUPAC name | 2-[4-ethoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LFSGJKSMSGVUON-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OCC)C(F)(F)F |
Computed by PubChem (NCBI)