Products 124324-24-9

CAS 124324-24-9 is the registry number for 2-Nonyl-1-Undecanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-nonylundecan-1-ol (CAS 124324-24-9) is a chemical compound with the molecular formula C20H42O and a molecular weight of 298.5 g/mol. IUPAC name: 2-nonylundecan-1-ol. InChIKey: ZPOYTBFBRNBWGV-UHFFFAOYSA-N.

Identity
Molecular formulaC20H42O
Molecular weight298.5 g/mol
IUPAC name2-nonylundecan-1-ol
InChIKeyZPOYTBFBRNBWGV-UHFFFAOYSA-N
SMILESCCCCCCCCCC(CCCCCCCCC)CO

Computed by PubChem (NCBI)