CAS 1243249-19-5 is the registry number for Paucinervin D. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,5-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene-7,8-diol (CAS 1243249-19-5) is a chemical compound with the molecular formula C27H40O3 and a molecular weight of 412.6 g/mol. IUPAC name: 2,5-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene-7,8-diol. InChIKey: BTLRXKRGQQIJSD-KDXVVQHGSA-N.
| Molecular formula | C27H40O3 |
|---|---|
| Molecular weight | 412.6 g/mol |
| IUPAC name | 2,5-dimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromene-7,8-diol |
| InChIKey | BTLRXKRGQQIJSD-KDXVVQHGSA-N |
| SMILES | CC1=CC(=C(C2=C1CCC(O2)(C)CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)O)O |
Computed by PubChem (NCBI)