CAS 1243249-98-0 is the registry number for 5-(1-Aminocyclohexyl)-1,3,4-thiadiazol-2-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(1-aminocyclohexyl)-1,3,4-thiadiazol-2-amine;dihydrochloride (CAS 1243249-98-0) is a chemical compound with the molecular formula C8H16Cl2N4S and a molecular weight of 271.21 g/mol. IUPAC name: 5-(1-aminocyclohexyl)-1,3,4-thiadiazol-2-amine;dihydrochloride. InChIKey: ICHWSDWLDMPULV-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N4S |
|---|---|
| Molecular weight | 271.21 g/mol |
| IUPAC name | 5-(1-aminocyclohexyl)-1,3,4-thiadiazol-2-amine;dihydrochloride |
| InChIKey | ICHWSDWLDMPULV-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=NN=C(S2)N)N.Cl.Cl |
Computed by PubChem (NCBI)