CAS 1243259-19-9 appears in our catalog under these names: LM11A 31 2HCl, (2S,3S)-2-Amino-3-methyl-N-(2-(4-morpholinyl)ethyl)pentanamide Hydrochloride, >95% (HPLC), LM11A-31 dihydrochloride/ 98%, LM11A–31 (hydrochloride), LM11A–31 dihydrochloride. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: on request, 2,5g, 250mg, 50mg, 10mg, 25mg, 100mg, 200mg.
(2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide;dihydrochloride (CAS 1243259-19-9) is a chemical compound with the molecular formula C12H27Cl2N3O2 and a molecular weight of 316.26 g/mol. IUPAC name: (2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide;dihydrochloride. InChIKey: LLIHJRRZJDEKLB-ULEGLUPFSA-N.
| Molecular formula | C12H27Cl2N3O2 |
|---|---|
| Molecular weight | 316.26 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-methyl-N-(2-morpholin-4-ylethyl)pentanamide;dihydrochloride |
| InChIKey | LLIHJRRZJDEKLB-ULEGLUPFSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NCCN1CCOCC1)N.Cl.Cl |
Computed by PubChem (NCBI)