CAS 124329-50-6 is the registry number for Tetraphenylphosphonium hexafluoroantimonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
Hexafluoroantimony(1-);tetraphenylphosphanium (CAS 124329-50-6) is a chemical compound with the molecular formula C24H20F6PSb and a molecular weight of 575.1 g/mol. IUPAC name: hexafluoroantimony(1-);tetraphenylphosphanium. InChIKey: VDFQTLYSKKHULX-UHFFFAOYSA-H.
| Molecular formula | C24H20F6PSb |
|---|---|
| Molecular weight | 575.1 g/mol |
| IUPAC name | hexafluoroantimony(1-);tetraphenylphosphanium |
| InChIKey | VDFQTLYSKKHULX-UHFFFAOYSA-H |
| SMILES | C1=CC=C(C=C1)[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.F[Sb-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)