CAS 1243308-37-3 appears in our catalog under these names: Edoxaban Impurity 33, Ethanediamide Impurity C HCL, Ethyl 2–((5–chloropyridin–2–yl)amino)–2–oxoacetate hydrochloride, 2-((5-Chloropyridin-2-yl)amino)-2-oxoacetic acid ethyl ester monohydrochloride, Ethyl 2-((5-chloropyridin-2-yl)amino)-2-oxoacetate hydrochloride 97%. Offered by: Chemat Brand, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 100g, 25g, 500g, 5g, 10g, 50g.
Ethyl 2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetate;hydrochloride (CAS 1243308-37-3) is a chemical compound with the molecular formula C9H10Cl2N2O3 and a molecular weight of 265.09 g/mol. IUPAC name: ethyl 2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetate;hydrochloride. InChIKey: AZWJPQKNPCTYCU-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O3 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | ethyl 2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetate;hydrochloride |
| InChIKey | AZWJPQKNPCTYCU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=NC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)