CAS 1243310-20-4 is the registry number for VU0366248. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3-chloro-2-fluorophenyl)-3-cyano-5-fluorobenzamide (CAS 1243310-20-4) is a chemical compound with the molecular formula C14H7ClF2N2O and a molecular weight of 292.67 g/mol. IUPAC name: N-(3-chloro-2-fluorophenyl)-3-cyano-5-fluorobenzamide. InChIKey: QDFPSPIHFOODSP-UHFFFAOYSA-N.
| Molecular formula | C14H7ClF2N2O |
|---|---|
| Molecular weight | 292.67 g/mol |
| IUPAC name | N-(3-chloro-2-fluorophenyl)-3-cyano-5-fluorobenzamide |
| InChIKey | QDFPSPIHFOODSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)NC(=O)C2=CC(=CC(=C2)C#N)F |
Computed by PubChem (NCBI)