CAS 124338-52-9 is the registry number for (2R,3r)-3-(benzyloxy)butan-2-ol, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R,3R)-3-phenylmethoxybutan-2-ol (CAS 124338-52-9) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 180.24 g/mol. IUPAC name: (2R,3R)-3-phenylmethoxybutan-2-ol. InChIKey: VQEAOBYESZEWRQ-NXEZZACHSA-N.
| Molecular formula | C11H16O2 |
|---|---|
| Molecular weight | 180.24 g/mol |
| IUPAC name | (2R,3R)-3-phenylmethoxybutan-2-ol |
| InChIKey | VQEAOBYESZEWRQ-NXEZZACHSA-N |
| SMILES | C[C@H]([C@@H](C)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)