CAS 1243540-90-0 is the registry number for N-(Acetyl) Duloxetine. Offered by: TRC. Available pack sizes: 100mg.
N-methyl-N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]acetamide (CAS 1243540-90-0) is a chemical compound with the molecular formula C20H21NO2S and a molecular weight of 339.5 g/mol. IUPAC name: N-methyl-N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]acetamide. InChIKey: XVGRKIDSOPYVEU-IBGZPJMESA-N.
| Molecular formula | C20H21NO2S |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | N-methyl-N-[(3S)-3-naphthalen-1-yloxy-3-thiophen-2-ylpropyl]acetamide |
| InChIKey | XVGRKIDSOPYVEU-IBGZPJMESA-N |
| SMILES | CC(=O)N(C)CC[C@@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)