CAS 124378-77-4 is the registry number for Enadoline. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, Get quote.
2-(1-benzofuran-4-yl)-N-methyl-N-[(5R,7S,8S)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide (CAS 124378-77-4) is a chemical compound with the molecular formula C24H32N2O3 and a molecular weight of 396.5 g/mol. IUPAC name: 2-(1-benzofuran-4-yl)-N-methyl-N-[(5R,7S,8S)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide. InChIKey: JMBYBVLCYODBJQ-HFMPRLQTSA-N.
| Molecular formula | C24H32N2O3 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | 2-(1-benzofuran-4-yl)-N-methyl-N-[(5R,7S,8S)-7-pyrrolidin-1-yl-1-oxaspiro[4.5]decan-8-yl]acetamide |
| InChIKey | JMBYBVLCYODBJQ-HFMPRLQTSA-N |
| SMILES | CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N3CCCC3)C(=O)CC4=C5C=COC5=CC=C4 |
Computed by PubChem (NCBI)