Products 124380-97-8
CAS 124380-97-8 is the registry number for Clozapine Analogues/ 99.6% (existing batch purity). Offered by: TargetMol. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
6-chloro-9-(4-methylpiperazin-1-yl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one (CAS 124380-97-8) is a chemical compound with the molecular formula C20H19ClN2O and a molecular weight of 338.8 g/mol. IUPAC name: 6-chloro-9-(4-methylpiperazin-1-yl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one. InChIKey: VXBLEHJKAURZBP-UHFFFAOYSA-N.
| Molecular formula | C20H19ClN2O |
|---|---|
| Molecular weight | 338.8 g/mol |
| IUPAC name | 6-chloro-9-(4-methylpiperazin-1-yl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-one |
| InChIKey | VXBLEHJKAURZBP-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=CC=CC=C3C(=O)C4=C2C=C(C=C4)Cl |
Computed by PubChem (NCBI)
Synonyms:
Clozapine Analogues, orb2281136