CAS 124389-29-3 is the registry number for 1,3-Bis(tridecafluorohexyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1,3-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzene (CAS 124389-29-3) is a chemical compound with the molecular formula C18H4F26 and a molecular weight of 714.2 g/mol. IUPAC name: 1,3-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzene. InChIKey: PJIMUKRRXVIXOA-UHFFFAOYSA-N.
| Molecular formula | C18H4F26 |
|---|---|
| Molecular weight | 714.2 g/mol |
| IUPAC name | 1,3-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzene |
| InChIKey | PJIMUKRRXVIXOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)