CAS 124402-18-2 appears in our catalog under these names: Dexpanthenol Impurity 7, Dexpanthenol Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5R)-3-hydroxy-4,4-dimethyl-5-propan-2-yloxolan-2-one (CAS 124402-18-2) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: (3R,5R)-3-hydroxy-4,4-dimethyl-5-propan-2-yloxolan-2-one. InChIKey: XNBZWYAKVZUULG-NKWVEPMBSA-N.
| Molecular formula | C9H16O3 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | (3R,5R)-3-hydroxy-4,4-dimethyl-5-propan-2-yloxolan-2-one |
| InChIKey | XNBZWYAKVZUULG-NKWVEPMBSA-N |
| SMILES | CC(C)[C@@H]1C([C@H](C(=O)O1)O)(C)C |
Computed by PubChem (NCBI)