Products 1244027-03-9
CAS 1244027-03-9 is the registry number for Cdc7-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,2-dimethyl-6-(5-methyl-1H-pyrazol-4-yl)-1,3-dihydrothieno[3,2-d]pyrimidin-4-one (CAS 1244027-03-9) is a chemical compound with the molecular formula C12H14N4OS and a molecular weight of 262.33 g/mol. IUPAC name: 2,2-dimethyl-6-(5-methyl-1H-pyrazol-4-yl)-1,3-dihydrothieno[3,2-d]pyrimidin-4-one. InChIKey: YFQSICRYULKECN-UHFFFAOYSA-N.
| Molecular formula | C12H14N4OS |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | 2,2-dimethyl-6-(5-methyl-1H-pyrazol-4-yl)-1,3-dihydrothieno[3,2-d]pyrimidin-4-one |
| InChIKey | YFQSICRYULKECN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1)C2=CC3=C(S2)C(=O)NC(N3)(C)C |
Computed by PubChem (NCBI)