Products 1244040-64-9
CAS 1244040-64-9 appears in our catalog under these names: Tetrazine-Ph-NHCO-C3-NHS ester/ 98.22% (existing batch purity), Tetrazine–Ph–NHCO–C3–NHS ester, Bz-Tz-NHS, Tetrazine-Ph-NHCO-C3-NHS ester, 98.40%, Tetrazine-Ph-NHCO-C3-NHS ester, 98%. Offered by: TargetMol, GLPBio, Iris Biotech, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
(2,5-dioxopyrrolidin-1-yl) 5-oxo-5-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]pentanoate (CAS 1244040-64-9) is a chemical compound with the molecular formula C18H18N6O5 and a molecular weight of 398.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 5-oxo-5-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]pentanoate. InChIKey: QDUUJWMNSUXICN-UHFFFAOYSA-N.
| Molecular formula | C18H18N6O5 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 5-oxo-5-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methylamino]pentanoate |
| InChIKey | QDUUJWMNSUXICN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCC(=O)NCC2=CC=C(C=C2)C3=NN=CN=N3 |
Computed by PubChem (NCBI)