CAS 124412-00-6 appears in our catalog under these names: 5-CFDA-AM, 5–CFDA–AM, 5-CFDA-AM, 99.81%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 10mg, 5mg, 10 mg, 5 mg.
Acetyloxymethyl 3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate (CAS 124412-00-6) is a chemical compound with the molecular formula C28H20O11 and a molecular weight of 532.4 g/mol. IUPAC name: acetyloxymethyl 3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate. InChIKey: YDBUJZYYYBVSEF-UHFFFAOYSA-N.
| Molecular formula | C28H20O11 |
|---|---|
| Molecular weight | 532.4 g/mol |
| IUPAC name | acetyloxymethyl 3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate |
| InChIKey | YDBUJZYYYBVSEF-UHFFFAOYSA-N |
| SMILES | CC(=O)OCOC(=O)C1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)OC(=O)C)OC5=C3C=CC(=C5)OC(=O)C)OC2=O |
Computed by PubChem (NCBI)