CAS 124436-59-5 appears in our catalog under these names: Pirodavir, Pirodavir, 95%, R 77975, Pirodavir/ 99.78% (existing batch purity), Pirodavir, >95.0%(HPLC). Offered by: GLPBio, Combi-blocks, TRC, TargetMol, TCI. Available pack sizes: 5mg, 10mg, 50mg, 100mg, 1mg, 25mg, 500mg, 2mg.
Ethyl 4-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]benzoate (CAS 124436-59-5) is a chemical compound with the molecular formula C21H27N3O3 and a molecular weight of 369.5 g/mol. IUPAC name: ethyl 4-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]benzoate. InChIKey: KCHIOGFOPPOUJC-UHFFFAOYSA-N.
| Molecular formula | C21H27N3O3 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | ethyl 4-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]benzoate |
| InChIKey | KCHIOGFOPPOUJC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)OCCC2CCN(CC2)C3=NN=C(C=C3)C |
Computed by PubChem (NCBI)