Products 1244948-87-5

CAS 1244948-87-5 is the registry number for 5-(Hydroxymethyl)thiazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(hydroxymethyl)-1,3-thiazole-2-carboxylic acid (CAS 1244948-87-5) is a chemical compound with the molecular formula C5H5NO3S and a molecular weight of 159.17 g/mol. IUPAC name: 5-(hydroxymethyl)-1,3-thiazole-2-carboxylic acid. InChIKey: JHEMMZHOQVGIBO-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5NO3S
Molecular weight159.17 g/mol
IUPAC name5-(hydroxymethyl)-1,3-thiazole-2-carboxylic acid
InChIKeyJHEMMZHOQVGIBO-UHFFFAOYSA-N
SMILESC1=C(SC(=N1)C(=O)O)CO

Computed by PubChem (NCBI)