CAS 1245010-72-3 appears in our catalog under these names: (2-Bromo-4,6-difluorophenyl)hydrazine hydrochloride, (2-bromo-4,6-difluorophenyl)hydrazine hydrochloride, 95%, 95%, (2-Bromo-4,6-difluorophenyl)hydrazine hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g.
(2-bromo-4,6-difluorophenyl)hydrazine;hydrochloride (CAS 1245010-72-3) is a chemical compound with the molecular formula C6H6BrClF2N2 and a molecular weight of 259.48 g/mol. IUPAC name: (2-bromo-4,6-difluorophenyl)hydrazine;hydrochloride. InChIKey: IOWKVZHOULRYKV-UHFFFAOYSA-N.
| Molecular formula | C6H6BrClF2N2 |
|---|---|
| Molecular weight | 259.48 g/mol |
| IUPAC name | (2-bromo-4,6-difluorophenyl)hydrazine;hydrochloride |
| InChIKey | IOWKVZHOULRYKV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)NN)Br)F.Cl |
Computed by PubChem (NCBI)