CAS 1245078-94-7 is the registry number for rel-(3R,4S)-1-Benzyl-4-(2,4-difluorophenyl)pyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-1-benzyl-4-(2,4-difluorophenyl)pyrrolidin-3-amine (CAS 1245078-94-7) is a chemical compound with the molecular formula C17H18F2N2 and a molecular weight of 288.33 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-(2,4-difluorophenyl)pyrrolidin-3-amine. InChIKey: DPZIIJYOANSEKM-WBVHZDCISA-N.
| Molecular formula | C17H18F2N2 |
|---|---|
| Molecular weight | 288.33 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-(2,4-difluorophenyl)pyrrolidin-3-amine |
| InChIKey | DPZIIJYOANSEKM-WBVHZDCISA-N |
| SMILES | C1[C@@H]([C@H](CN1CC2=CC=CC=C2)N)C3=C(C=C(C=C3)F)F |
Computed by PubChem (NCBI)