CAS 1245284-29-0 is the registry number for 6,7-Dimethoxy-3-(trimethylstannyl)-isoquinoline. Offered by: TRC. Available pack sizes: 25mg.
(6,7-dimethoxyisoquinolin-3-yl)-trimethylstannane (CAS 1245284-29-0) is a chemical compound with the molecular formula C14H19NO2Sn and a molecular weight of 352.02 g/mol. IUPAC name: (6,7-dimethoxyisoquinolin-3-yl)-trimethylstannane. InChIKey: CYDOJNHZLMQALH-UHFFFAOYSA-N.
| Molecular formula | C14H19NO2Sn |
|---|---|
| Molecular weight | 352.02 g/mol |
| IUPAC name | (6,7-dimethoxyisoquinolin-3-yl)-trimethylstannane |
| InChIKey | CYDOJNHZLMQALH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=NC(=CC2=C1)[Sn](C)(C)C)OC |
Computed by PubChem (NCBI)