CAS 1245401-04-0 is the registry number for Nalpha-acetyl-l-arginine amide acetate salt, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(2S)-2-acetamido-5-(diaminomethylideneamino)pentanamide;acetic acid (CAS 1245401-04-0) is a chemical compound with the molecular formula C10H21N5O4 and a molecular weight of 275.31 g/mol. IUPAC name: (2S)-2-acetamido-5-(diaminomethylideneamino)pentanamide;acetic acid. InChIKey: KDWPITFWGMXUHM-RGMNGODLSA-N.
| Molecular formula | C10H21N5O4 |
|---|---|
| Molecular weight | 275.31 g/mol |
| IUPAC name | (2S)-2-acetamido-5-(diaminomethylideneamino)pentanamide;acetic acid |
| InChIKey | KDWPITFWGMXUHM-RGMNGODLSA-N |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)N.CC(=O)O |
Computed by PubChem (NCBI)