Products 1245401-04-0

CAS 1245401-04-0 is the registry number for Nalpha-acetyl-l-arginine amide acetate salt, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2S)-2-acetamido-5-(diaminomethylideneamino)pentanamide;acetic acid (CAS 1245401-04-0) is a chemical compound with the molecular formula C10H21N5O4 and a molecular weight of 275.31 g/mol. IUPAC name: (2S)-2-acetamido-5-(diaminomethylideneamino)pentanamide;acetic acid. InChIKey: KDWPITFWGMXUHM-RGMNGODLSA-N.

Identity
Molecular formulaC10H21N5O4
Molecular weight275.31 g/mol
IUPAC name(2S)-2-acetamido-5-(diaminomethylideneamino)pentanamide;acetic acid
InChIKeyKDWPITFWGMXUHM-RGMNGODLSA-N
SMILESCC(=O)N[C@@H](CCCN=C(N)N)C(=O)N.CC(=O)O

Computed by PubChem (NCBI)