CAS 1245514-78-6 appears in our catalog under these names: 6–BROMO–2',3',5',6'–TETRAHYDROSPIRO(INDENE–2,4'–PYRAN)–1(3H)–ONE, 6-Bromo-2',3',5',6'-tetrahydrospiro[indene-2,4'-pyran]-1(3h)-one, 95%, 6-Bromo-2',3',5',6'-tetrahydrospiro(indene-2,4'-pyran)-1(3H)-one, 97%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
6-bromospiro[3H-indene-2,4'-oxane]-1-one (CAS 1245514-78-6) is a chemical compound with the molecular formula C13H13BrO2 and a molecular weight of 281.14 g/mol. IUPAC name: 6-bromospiro[3H-indene-2,4'-oxane]-1-one. InChIKey: YAYQYDYHADUGLU-UHFFFAOYSA-N.
| Molecular formula | C13H13BrO2 |
|---|---|
| Molecular weight | 281.14 g/mol |
| IUPAC name | 6-bromospiro[3H-indene-2,4'-oxane]-1-one |
| InChIKey | YAYQYDYHADUGLU-UHFFFAOYSA-N |
| SMILES | C1COCCC12CC3=C(C2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)