Products 1245533-07-6

CAS 1245533-07-6 is the registry number for 2-Methoxy-3,4-dimethylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methoxy-3,4-dimethylbenzoic acid (CAS 1245533-07-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-methoxy-3,4-dimethylbenzoic acid. InChIKey: HWHFXXPMPGGCFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O3
Molecular weight180.20 g/mol
IUPAC name2-methoxy-3,4-dimethylbenzoic acid
InChIKeyHWHFXXPMPGGCFJ-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)C(=O)O)OC)C

Computed by PubChem (NCBI)