CAS 1245533-07-6 is the registry number for 2-Methoxy-3,4-dimethylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methoxy-3,4-dimethylbenzoic acid (CAS 1245533-07-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-methoxy-3,4-dimethylbenzoic acid. InChIKey: HWHFXXPMPGGCFJ-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-methoxy-3,4-dimethylbenzoic acid |
| InChIKey | HWHFXXPMPGGCFJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)O)OC)C |
Computed by PubChem (NCBI)