Products 1245563-08-9
CAS 1245563-08-9 is the registry number for 5-Bromo-2-(2,2,2-trifluoroethyl)aminopyrimidine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine (CAS 1245563-08-9) is a chemical compound with the molecular formula C6H5BrF3N3 and a molecular weight of 256.02 g/mol. IUPAC name: 5-bromo-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine. InChIKey: XAHKWJXWKQLGSJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BrF3N3 |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 5-bromo-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
| InChIKey | XAHKWJXWKQLGSJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)NCC(F)(F)F)Br |
Computed by PubChem (NCBI)