Products 1245568-74-4

CAS 1245568-74-4 is the registry number for N-(Thiophen-2-ylmethyl)cyclopentanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

N-(thiophen-2-ylmethyl)cyclopentanamine;hydrochloride (CAS 1245568-74-4) is a chemical compound with the molecular formula C10H16ClNS and a molecular weight of 217.76 g/mol. IUPAC name: N-(thiophen-2-ylmethyl)cyclopentanamine;hydrochloride. InChIKey: CQWMBBHKXJIMPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16ClNS
Molecular weight217.76 g/mol
IUPAC nameN-(thiophen-2-ylmethyl)cyclopentanamine;hydrochloride
InChIKeyCQWMBBHKXJIMPZ-UHFFFAOYSA-N
SMILESC1CCC(C1)NCC2=CC=CS2.Cl

Computed by PubChem (NCBI)