Products 1245568-85-7
CAS 1245568-85-7 is the registry number for (2-Chloro-6-fluorobenzyl)glycine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-chloro-6-fluorophenyl)methylamino]acetic acid;hydrochloride (CAS 1245568-85-7) is a chemical compound with the molecular formula C9H10Cl2FNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-[(2-chloro-6-fluorophenyl)methylamino]acetic acid;hydrochloride. InChIKey: BOHUUOCOWPRFLG-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2FNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-[(2-chloro-6-fluorophenyl)methylamino]acetic acid;hydrochloride |
| InChIKey | BOHUUOCOWPRFLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CNCC(=O)O)F.Cl |
Computed by PubChem (NCBI)