CAS 1245648-97-8 appears in our catalog under these names: 8-Iodo-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 95%, 8-Iodo-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 95%, 95%, 8-Iodo-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1245648-97-8) is a chemical compound with the molecular formula C6H5IN4 and a molecular weight of 260.04 g/mol. IUPAC name: 8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: TWHJYZNVKBUSQM-UHFFFAOYSA-N.
| Molecular formula | C6H5IN4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | TWHJYZNVKBUSQM-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)N)C(=C1)I |
Computed by PubChem (NCBI)