CAS 1245734-61-5 appears in our catalog under these names: TK05, 5-((5-((4-Chlorophenyl)(cyclopropylmethyl)amino)-2-pyridinyl)carbonyl)-2-(4-methoxybenzoyl)benzoic acid, TK05, 99+%, TK05, 98.00%, 98.00%, TK05, 97.05%. Offered by: GLPBio, Biosynth, AmBeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, 100mg, 5 mg, 10 mg.
5-[5-[4-chloro-N-(cyclopropylmethyl)anilino]pyridine-2-carbonyl]-2-(4-methoxybenzoyl)benzoic acid (CAS 1245734-61-5) is a chemical compound with the molecular formula C31H25ClN2O5 and a molecular weight of 541.0 g/mol. IUPAC name: 5-[5-[4-chloro-N-(cyclopropylmethyl)anilino]pyridine-2-carbonyl]-2-(4-methoxybenzoyl)benzoic acid. InChIKey: GRDDFJXOEAJYCT-UHFFFAOYSA-N.
| Molecular formula | C31H25ClN2O5 |
|---|---|
| Molecular weight | 541.0 g/mol |
| IUPAC name | 5-[5-[4-chloro-N-(cyclopropylmethyl)anilino]pyridine-2-carbonyl]-2-(4-methoxybenzoyl)benzoic acid |
| InChIKey | GRDDFJXOEAJYCT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)C(=O)C3=NC=C(C=C3)N(CC4CC4)C5=CC=C(C=C5)Cl)C(=O)O |
Computed by PubChem (NCBI)