CAS 1245782-58-4 is the registry number for 2-(tert-Butyldimethylsilyl)-4-methylthiazole, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
Tert-butyl-dimethyl-(4-methyl-1,3-thiazol-2-yl)silane (CAS 1245782-58-4) is a chemical compound with the molecular formula C10H19NSSi and a molecular weight of 213.42 g/mol. IUPAC name: tert-butyl-dimethyl-(4-methyl-1,3-thiazol-2-yl)silane. InChIKey: OHCKALFODDMEQM-UHFFFAOYSA-N.
| Molecular formula | C10H19NSSi |
|---|---|
| Molecular weight | 213.42 g/mol |
| IUPAC name | tert-butyl-dimethyl-(4-methyl-1,3-thiazol-2-yl)silane |
| InChIKey | OHCKALFODDMEQM-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)