CAS 1245906-64-2 appears in our catalog under these names: Potassium (5–bromo–2–fluoropyridin–3–yl)trifluoroborate, Potassium (5-bromo-2-fluoropyridin-3-yl)trifluoroborate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Potassium (5-bromo-2-fluoro-3-pyridinyl)-trifluoroboranuide (CAS 1245906-64-2) is a chemical compound with the molecular formula C5H2BBrF4KN and a molecular weight of 281.89 g/mol. IUPAC name: potassium (5-bromo-2-fluoro-3-pyridinyl)-trifluoroboranuide. InChIKey: HTCGTCBBPPXGCU-UHFFFAOYSA-N.
| Molecular formula | C5H2BBrF4KN |
|---|---|
| Molecular weight | 281.89 g/mol |
| IUPAC name | potassium (5-bromo-2-fluoro-3-pyridinyl)-trifluoroboranuide |
| InChIKey | HTCGTCBBPPXGCU-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CN=C1F)Br)(F)(F)F.[K+] |
Computed by PubChem (NCBI)