CAS 1245946-78-4 is the registry number for (AZIDOMETHYL)PHENETHYLTRIMETHOXYSILANE. Offered by: GLPBio. Available pack sizes: 5g.
2-[4-(azidomethyl)phenyl]ethyl-trimethoxysilane (CAS 1245946-78-4) is a chemical compound with the molecular formula C12H19N3O3Si and a molecular weight of 281.38 g/mol. IUPAC name: 2-[4-(azidomethyl)phenyl]ethyl-trimethoxysilane. InChIKey: WYYVVTUCUPSNST-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O3Si |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | 2-[4-(azidomethyl)phenyl]ethyl-trimethoxysilane |
| InChIKey | WYYVVTUCUPSNST-UHFFFAOYSA-N |
| SMILES | CO[Si](CCC1=CC=C(C=C1)CN=[N+]=[N-])(OC)OC |
Computed by PubChem (NCBI)